ChemNet > CAS > 175278-51-0 3-{2-[(4-chloorfenyl)thio]-5-nitrofenyl}acrylzuur
175278-51-0 3-{2-[(4-chloorfenyl)thio]-5-nitrofenyl}acrylzuur
| Naam product |
3-{2-[(4-chloorfenyl)thio]-5-nitrofenyl}acrylzuur |
| Synoniemen |
3-[2-[(4-chloorfenyl)thio]-5-nitrofenyl]acrylzuur; (2Z)-3-{2-[(4-chloorfenyl)sulfanyl]-5-nitrofenyl}prop-2-eenzuur |
| Engelse naam |
3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid; 3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
| MF |
C15H10ClNO4S |
| Molecuulgewicht |
335.7622 |
| InChI |
InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
| CAS-nummer |
175278-51-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.5g/cm3 |
| Smeltpunt |
212℃ |
| Kookpunt |
531.7°C at 760 mmHg |
| Brekingsindex |
1.694 |
| Vlampunt |
275.4°C |
| Dampdruk |
3.9E-12mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|